CAS 1173022-61-1 is the registry number for 3-Methylxanthine-2,4,5,6-13C4, 1,3,9-15N3, 98% 98%atom%13C,98%atom%15N. Offered by: Chemat Brand. Available pack sizes: on request.
3-methyl-7H-purine-2,6-dione (CAS 1173022-61-1) is a chemical compound with the molecular formula C6H6N4O2 and a molecular weight of 173.09 g/mol. IUPAC name: 3-methyl-7H-purine-2,6-dione. InChIKey: GMSNIKWWOQHZGF-UDDVCBLJSA-N.
| Molecular formula | C6H6N4O2 |
|---|---|
| Molecular weight | 173.09 g/mol |
| IUPAC name | 3-methyl-7H-purine-2,6-dione |
| InChIKey | GMSNIKWWOQHZGF-UDDVCBLJSA-N |
| SMILES | C[15N]1[13C]2=[13C]([13C](=O)[15NH][13C]1=O)NC=[15N]2 |
Computed by PubChem (NCBI)