CAS 6164-78-9 appears in our catalog under these names: 2,3-Pyrazinedicarboxamide, 95%, 2,3-Pyrazinedicarboxamide, ≥95%, ≥95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 1g.
Pyrazine-2,3-dicarboxamide (CAS 6164-78-9) is a chemical compound with the molecular formula C6H6N4O2 and a molecular weight of 166.14 g/mol. IUPAC name: pyrazine-2,3-dicarboxamide. InChIKey: TZMYZOQDDVSLJU-UHFFFAOYSA-N.
| Molecular formula | C6H6N4O2 |
|---|---|
| Molecular weight | 166.14 g/mol |
| IUPAC name | pyrazine-2,3-dicarboxamide |
| InChIKey | TZMYZOQDDVSLJU-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C(=N1)C(=O)N)C(=O)N |
Computed by PubChem (NCBI)