Products 1006725-83-2
CAS 1006725-83-2 is the registry number for tert-butyl N-[(2S,3S)-2-(hydroxymethyl)oxetan-3-yl]carbamate, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Tert-butyl N-[(2S,3S)-2-(hydroxymethyl)oxetan-3-yl]carbamate (CAS 1006725-83-2) is a chemical compound with the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. IUPAC name: tert-butyl N-[(2S,3S)-2-(hydroxymethyl)oxetan-3-yl]carbamate. InChIKey: AEIVOTLOANDCEL-NKWVEPMBSA-N.
| Molecular formula | C9H17NO4 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | tert-butyl N-[(2S,3S)-2-(hydroxymethyl)oxetan-3-yl]carbamate |
| InChIKey | AEIVOTLOANDCEL-NKWVEPMBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CO[C@@H]1CO |
Computed by PubChem (NCBI)