Products 1007878-92-3
CAS 1007878-92-3 appears in our catalog under these names: 2-(2-Chlorophenyl)-2-(dimethylamino)acetic acid, 95%, 2-(2-Chlorophenyl)-2-(dimethylamino)acetic acid, 95+%, 2-(2-Chlorophenyl)-2-(dimethylamino)acetic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 10g, 250mg, 1g, 2,5g.
2-(2-chlorophenyl)-2-(dimethylamino)acetic acid (CAS 1007878-92-3) is a chemical compound with the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. IUPAC name: 2-(2-chlorophenyl)-2-(dimethylamino)acetic acid. InChIKey: LIXFURHZDYVNLV-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO2 |
|---|---|
| Molecular weight | 213.66 g/mol |
| IUPAC name | 2-(2-chlorophenyl)-2-(dimethylamino)acetic acid |
| InChIKey | LIXFURHZDYVNLV-UHFFFAOYSA-N |
| SMILES | CN(C)C(C1=CC=CC=C1Cl)C(=O)O |
Computed by PubChem (NCBI)