CAS 1007880-13-8 is the registry number for (R)–2–Cyclopropyl–2–((methoxycarbonyl)amino)acetic acid. Offered by: GLPBio. Available pack sizes: 1g.
(2R)-2-cyclopropyl-2-(methoxycarbonylamino)acetic acid (CAS 1007880-13-8) is a chemical compound with the molecular formula C7H11NO4 and a molecular weight of 173.17 g/mol. IUPAC name: (2R)-2-cyclopropyl-2-(methoxycarbonylamino)acetic acid. InChIKey: ZTGALQVOXKWCNJ-RXMQYKEDSA-N.
| Molecular formula | C7H11NO4 |
|---|---|
| Molecular weight | 173.17 g/mol |
| IUPAC name | (2R)-2-cyclopropyl-2-(methoxycarbonylamino)acetic acid |
| InChIKey | ZTGALQVOXKWCNJ-RXMQYKEDSA-N |
| SMILES | COC(=O)N[C@H](C1CC1)C(=O)O |
Computed by PubChem (NCBI)