Products 1007885-57-5

CAS 1007885-57-5 appears in our catalog under these names: (S)-2-CYCLOPROPYL-2-((METHOXYCARBONYL)AMINO)ACETIC ACID, 95%, (S)–2–Cyclopropyl–2–((methoxycarbonyl)amino)acetic acid. Offered by: AmBeed, GLPBio. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

(2S)-2-cyclopropyl-2-(methoxycarbonylamino)acetic acid (CAS 1007885-57-5) is a chemical compound with the molecular formula C7H11NO4 and a molecular weight of 173.17 g/mol. IUPAC name: (2S)-2-cyclopropyl-2-(methoxycarbonylamino)acetic acid. InChIKey: ZTGALQVOXKWCNJ-YFKPBYRVSA-N.

Identity
Molecular formulaC7H11NO4
Molecular weight173.17 g/mol
IUPAC name(2S)-2-cyclopropyl-2-(methoxycarbonylamino)acetic acid
InChIKeyZTGALQVOXKWCNJ-YFKPBYRVSA-N
SMILESCOC(=O)N[C@@H](C1CC1)C(=O)O

Computed by PubChem (NCBI)