CAS 1008-58-8 is the registry number for 5-Chloro-3,6-dimethylbenzofuran, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-chloro-3,6-dimethyl-1-benzofuran (CAS 1008-58-8) is a chemical compound with the molecular formula C10H9ClO and a molecular weight of 180.63 g/mol. IUPAC name: 5-chloro-3,6-dimethyl-1-benzofuran. InChIKey: LARYJSDQUOGRPE-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO |
|---|---|
| Molecular weight | 180.63 g/mol |
| IUPAC name | 5-chloro-3,6-dimethyl-1-benzofuran |
| InChIKey | LARYJSDQUOGRPE-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1Cl)C(=CO2)C |
Computed by PubChem (NCBI)