Products 1008704-29-7
CAS 1008704-29-7 is the registry number for 2-(3,4-Dichlorobenzenesulfonamido)propanoic acid. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
2-[(3,4-dichlorophenyl)sulfonylamino]propanoic acid (CAS 1008704-29-7) is a chemical compound with the molecular formula C9H9Cl2NO4S and a molecular weight of 298.14 g/mol. IUPAC name: 2-[(3,4-dichlorophenyl)sulfonylamino]propanoic acid. InChIKey: KWFPRFAPKAJBSU-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2NO4S |
|---|---|
| Molecular weight | 298.14 g/mol |
| IUPAC name | 2-[(3,4-dichlorophenyl)sulfonylamino]propanoic acid |
| InChIKey | KWFPRFAPKAJBSU-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)NS(=O)(=O)C1=CC(=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)