Products 4793-25-3
CAS 4793-25-3 appears in our catalog under these names: Ethyl 2,4-Dichloro-5-sulphamoylbenzoate, Ethyl 2,4-dichloro-5-sulfamoylbenzoate. Offered by: Mikromol, Biosynth. Available pack sizes: 4x25mg, 25mg, 1g, 100mg.
Ethyl 2,4-dichloro-5-sulfamoylbenzoate (CAS 4793-25-3) is a chemical compound with the molecular formula C9H9Cl2NO4S and a molecular weight of 298.14 g/mol. IUPAC name: ethyl 2,4-dichloro-5-sulfamoylbenzoate. InChIKey: LSXBNLARBXRUOW-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2NO4S |
|---|---|
| Molecular weight | 298.14 g/mol |
| IUPAC name | ethyl 2,4-dichloro-5-sulfamoylbenzoate |
| InChIKey | LSXBNLARBXRUOW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1Cl)Cl)S(=O)(=O)N |
Computed by PubChem (NCBI)