CAS 1461705-33-8 appears in our catalog under these names: 5-Chloro-4-acetamido-2-methoxybenzene-1-sulfonyl chloride, 98%, 5-Chloro-4-acetamido-2-methoxybenzene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-acetamido-5-chloro-2-methoxybenzenesulfonyl chloride (CAS 1461705-33-8) is a chemical compound with the molecular formula C9H9Cl2NO4S and a molecular weight of 298.14 g/mol. IUPAC name: 4-acetamido-5-chloro-2-methoxybenzenesulfonyl chloride. InChIKey: WJXWQRAKSPMCOM-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2NO4S |
|---|---|
| Molecular weight | 298.14 g/mol |
| IUPAC name | 4-acetamido-5-chloro-2-methoxybenzenesulfonyl chloride |
| InChIKey | WJXWQRAKSPMCOM-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC(=C(C=C1Cl)S(=O)(=O)Cl)OC |
Computed by PubChem (NCBI)