Products 1481595-14-5

CAS 1481595-14-5 is the registry number for 5-Chloro-2-methoxy-3-(methylcarbamoyl)benzene-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

5-chloro-2-methoxy-3-(methylcarbamoyl)benzenesulfonyl chloride (CAS 1481595-14-5) is a chemical compound with the molecular formula C9H9Cl2NO4S and a molecular weight of 298.14 g/mol. IUPAC name: 5-chloro-2-methoxy-3-(methylcarbamoyl)benzenesulfonyl chloride. InChIKey: BYEHDACQOCMNTN-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9Cl2NO4S
Molecular weight298.14 g/mol
IUPAC name5-chloro-2-methoxy-3-(methylcarbamoyl)benzenesulfonyl chloride
InChIKeyBYEHDACQOCMNTN-UHFFFAOYSA-N
SMILESCNC(=O)C1=C(C(=CC(=C1)Cl)S(=O)(=O)Cl)OC

Computed by PubChem (NCBI)