Products 2756590-21-1
CAS 2756590-21-1 is the registry number for Methyl 2,6-dichloro-4-((methylsulfonyl)methyl)nicotinate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2,6-dichloro-4-(methylsulfonylmethyl)pyridine-3-carboxylate (CAS 2756590-21-1) is a chemical compound with the molecular formula C9H9Cl2NO4S and a molecular weight of 298.14 g/mol. IUPAC name: methyl 2,6-dichloro-4-(methylsulfonylmethyl)pyridine-3-carboxylate. InChIKey: APALPYQMALQXOK-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2NO4S |
|---|---|
| Molecular weight | 298.14 g/mol |
| IUPAC name | methyl 2,6-dichloro-4-(methylsulfonylmethyl)pyridine-3-carboxylate |
| InChIKey | APALPYQMALQXOK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(N=C(C=C1CS(=O)(=O)C)Cl)Cl |
Computed by PubChem (NCBI)