Products 1008975-54-9

CAS 1008975-54-9 is the registry number for 1-(Methylsulfonyl)piperidine-2-carboxylic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

1-methylsulfonylpiperidine-2-carboxylic acid (CAS 1008975-54-9) is a chemical compound with the molecular formula C7H13NO4S and a molecular weight of 207.25 g/mol. IUPAC name: 1-methylsulfonylpiperidine-2-carboxylic acid. InChIKey: FHJBZSSPDCFJEG-UHFFFAOYSA-N.

Identity
Molecular formulaC7H13NO4S
Molecular weight207.25 g/mol
IUPAC name1-methylsulfonylpiperidine-2-carboxylic acid
InChIKeyFHJBZSSPDCFJEG-UHFFFAOYSA-N
SMILESCS(=O)(=O)N1CCCCC1C(=O)O

Computed by PubChem (NCBI)