CAS 51070-58-7 appears in our catalog under these names: N-(1,1-Dioxidotetrahydro-3-thienyl)-n-methylglycine, 95%, ((1,1-Dioxo-tetrahydro-1lambda*6*-thiophen-3-yl)-methyl-amino)-acetic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 2,5g.
2-[(1,1-dioxothiolan-3-yl)-methylamino]acetic acid (CAS 51070-58-7) is a chemical compound with the molecular formula C7H13NO4S and a molecular weight of 207.25 g/mol. IUPAC name: 2-[(1,1-dioxothiolan-3-yl)-methylamino]acetic acid. InChIKey: YKGBSBFRRDPBPB-UHFFFAOYSA-N.
| Molecular formula | C7H13NO4S |
|---|---|
| Molecular weight | 207.25 g/mol |
| IUPAC name | 2-[(1,1-dioxothiolan-3-yl)-methylamino]acetic acid |
| InChIKey | YKGBSBFRRDPBPB-UHFFFAOYSA-N |
| SMILES | CN(CC(=O)O)C1CCS(=O)(=O)C1 |
Computed by PubChem (NCBI)