Products 247109-39-3

CAS 247109-39-3 is the registry number for N-(1,1-Dioxidotetrahydro-3-thienyl)-beta-alanine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

3-[(1,1-dioxothiolan-3-yl)amino]propanoic acid (CAS 247109-39-3) is a chemical compound with the molecular formula C7H13NO4S and a molecular weight of 207.25 g/mol. IUPAC name: 3-[(1,1-dioxothiolan-3-yl)amino]propanoic acid. InChIKey: IKVXZBQFTASZSZ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H13NO4S
Molecular weight207.25 g/mol
IUPAC name3-[(1,1-dioxothiolan-3-yl)amino]propanoic acid
InChIKeyIKVXZBQFTASZSZ-UHFFFAOYSA-N
SMILESC1CS(=O)(=O)CC1NCCC(=O)O

Computed by PubChem (NCBI)