CAS 887245-52-5 appears in our catalog under these names: Methyl 4-aminotetrahydro-2h-thiopyran-4-carboxylate 1,1-dioxide, 95%, Methyl 4-aminotetrahydro-2H-thiopyran-4-carboxylate 1,1-dioxide, 98%, Methyl 4-aminotetrahydro-2H-thiopyran-4-carboxylate 1,1-dioxide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 5g, 0,5g, 50mg.
Methyl 4-amino-1,1-dioxothiane-4-carboxylate (CAS 887245-52-5) is a chemical compound with the molecular formula C7H13NO4S and a molecular weight of 207.25 g/mol. IUPAC name: methyl 4-amino-1,1-dioxothiane-4-carboxylate. InChIKey: PRVCXEQAGFJWKX-UHFFFAOYSA-N.
| Molecular formula | C7H13NO4S |
|---|---|
| Molecular weight | 207.25 g/mol |
| IUPAC name | methyl 4-amino-1,1-dioxothiane-4-carboxylate |
| InChIKey | PRVCXEQAGFJWKX-UHFFFAOYSA-N |
| SMILES | COC(=O)C1(CCS(=O)(=O)CC1)N |
Computed by PubChem (NCBI)