Products 849928-19-4

CAS 849928-19-4 is the registry number for 3-(1,1-Dioxidothiomorpholin-4-yl)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

3-(1,1-dioxo-1,4-thiazinan-4-yl)propanoic acid (CAS 849928-19-4) is a chemical compound with the molecular formula C7H13NO4S and a molecular weight of 207.25 g/mol. IUPAC name: 3-(1,1-dioxo-1,4-thiazinan-4-yl)propanoic acid. InChIKey: ZZDGJZCNQLBHJY-UHFFFAOYSA-N.

Identity
Molecular formulaC7H13NO4S
Molecular weight207.25 g/mol
IUPAC name3-(1,1-dioxo-1,4-thiazinan-4-yl)propanoic acid
InChIKeyZZDGJZCNQLBHJY-UHFFFAOYSA-N
SMILESC1CS(=O)(=O)CCN1CCC(=O)O

Computed by PubChem (NCBI)