Products 1568010-70-7

CAS 1568010-70-7 appears in our catalog under these names: (3S)-1-Methanesulfonylpiperidine-3-carboxylic acid, 95%, (3S)-1-Methanesulfonylpiperidine-3-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 100mg, 5g, 250mg, 10g, 2,5g.

Structural formula: {0} (CAS {1})

(3S)-1-methylsulfonylpiperidine-3-carboxylic acid (CAS 1568010-70-7) is a chemical compound with the molecular formula C7H13NO4S and a molecular weight of 207.25 g/mol. IUPAC name: (3S)-1-methylsulfonylpiperidine-3-carboxylic acid. InChIKey: JYNPFTCJJVIWTD-LURJTMIESA-N.

Identity
Molecular formulaC7H13NO4S
Molecular weight207.25 g/mol
IUPAC name(3S)-1-methylsulfonylpiperidine-3-carboxylic acid
InChIKeyJYNPFTCJJVIWTD-LURJTMIESA-N
SMILESCS(=O)(=O)N1CCC[C@@H](C1)C(=O)O

Computed by PubChem (NCBI)