CAS 247109-40-6 is the registry number for N-(1,1-Dioxidotetrahydro-3-thienyl)alanine, 95%. Offered by: Combi-blocks. Available pack sizes: 50g, 1g, 25g, 10g, 5g.
2-[(1,1-dioxothiolan-3-yl)amino]propanoic acid (CAS 247109-40-6) is a chemical compound with the molecular formula C7H13NO4S and a molecular weight of 207.25 g/mol. IUPAC name: 2-[(1,1-dioxothiolan-3-yl)amino]propanoic acid. InChIKey: RIBCAVCPRSRWDL-UHFFFAOYSA-N.
| Molecular formula | C7H13NO4S |
|---|---|
| Molecular weight | 207.25 g/mol |
| IUPAC name | 2-[(1,1-dioxothiolan-3-yl)amino]propanoic acid |
| InChIKey | RIBCAVCPRSRWDL-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)NC1CCS(=O)(=O)C1 |
Computed by PubChem (NCBI)