Products 1008997-34-9
CAS 1008997-34-9 appears in our catalog under these names: 2-[(3-Chlorobenzene)sulfonamido]propanoic acid, 95%, 2–(3–Chlorobenzenesulfonamido)propanoic acid, 2-(3-Chlorobenzenesulfonamido)propanoic acid. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 250mg, 1g, 100mg, 2,5g.
2-[(3-chlorophenyl)sulfonylamino]propanoic acid (CAS 1008997-34-9) is a chemical compound with the molecular formula C9H10ClNO4S and a molecular weight of 263.70 g/mol. IUPAC name: 2-[(3-chlorophenyl)sulfonylamino]propanoic acid. InChIKey: LKWSJYWATSRWQH-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO4S |
|---|---|
| Molecular weight | 263.70 g/mol |
| IUPAC name | 2-[(3-chlorophenyl)sulfonylamino]propanoic acid |
| InChIKey | LKWSJYWATSRWQH-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)NS(=O)(=O)C1=CC(=CC=C1)Cl |
Computed by PubChem (NCBI)