CAS 90410-27-8 is the registry number for 2-([(4-Chlorophenyl)sulfonyl]amino)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
2-[(4-chlorophenyl)sulfonylamino]propanoic acid (CAS 90410-27-8) is a chemical compound with the molecular formula C9H10ClNO4S and a molecular weight of 263.70 g/mol. IUPAC name: 2-[(4-chlorophenyl)sulfonylamino]propanoic acid. InChIKey: SGHZTBDKKOKWDI-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO4S |
|---|---|
| Molecular weight | 263.70 g/mol |
| IUPAC name | 2-[(4-chlorophenyl)sulfonylamino]propanoic acid |
| InChIKey | SGHZTBDKKOKWDI-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)NS(=O)(=O)C1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)