Products 690646-02-7

CAS 690646-02-7 is the registry number for 3-([(3-Chlorophenyl)sulfonyl]amino)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

3-[(3-chlorophenyl)sulfonylamino]propanoic acid (CAS 690646-02-7) is a chemical compound with the molecular formula C9H10ClNO4S and a molecular weight of 263.70 g/mol. IUPAC name: 3-[(3-chlorophenyl)sulfonylamino]propanoic acid. InChIKey: JBXVVIWGDKGSGK-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10ClNO4S
Molecular weight263.70 g/mol
IUPAC name3-[(3-chlorophenyl)sulfonylamino]propanoic acid
InChIKeyJBXVVIWGDKGSGK-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)Cl)S(=O)(=O)NCCC(=O)O

Computed by PubChem (NCBI)