Products 746655-82-3
CAS 746655-82-3 appears in our catalog under these names: 3-(2-Chlorobenzenesulfonamido)propanoic acid, 3-(2-Chlorobenzenesulfonamido)propanoic acid, 95%, 3-([(2-Chlorophenyl)sulfonyl]amino)propanoic acid, 95%. Offered by: Biosynth, AmBeed, Combi-blocks. Available pack sizes: 0,5g, 5g, 10g, 1g, 250mg.
3-[(2-chlorophenyl)sulfonylamino]propanoic acid (CAS 746655-82-3) is a chemical compound with the molecular formula C9H10ClNO4S and a molecular weight of 263.70 g/mol. IUPAC name: 3-[(2-chlorophenyl)sulfonylamino]propanoic acid. InChIKey: HJRPPGPCPXRMFK-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO4S |
|---|---|
| Molecular weight | 263.70 g/mol |
| IUPAC name | 3-[(2-chlorophenyl)sulfonylamino]propanoic acid |
| InChIKey | HJRPPGPCPXRMFK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)S(=O)(=O)NCCC(=O)O)Cl |
Computed by PubChem (NCBI)