Products 5804-73-9

CAS 5804-73-9 is the registry number for 5-(Acetylamino)-2-methoxybenzenesulfonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

5-acetamido-2-methoxybenzenesulfonyl chloride (CAS 5804-73-9) is a chemical compound with the molecular formula C9H10ClNO4S and a molecular weight of 263.70 g/mol. IUPAC name: 5-acetamido-2-methoxybenzenesulfonyl chloride. InChIKey: VWKRNDWDKNOMAD-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10ClNO4S
Molecular weight263.70 g/mol
IUPAC name5-acetamido-2-methoxybenzenesulfonyl chloride
InChIKeyVWKRNDWDKNOMAD-UHFFFAOYSA-N
SMILESCC(=O)NC1=CC(=C(C=C1)OC)S(=O)(=O)Cl

Computed by PubChem (NCBI)