CAS 21208-62-8 appears in our catalog under these names: (4-Chlorosulfonyl-phenyl)-carbamic acid ethyl ester, 95%, Ethyl (4-(chlorosulfonyl)phenyl)carbamate, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 100mg.
Ethyl N-(4-chlorosulfonylphenyl)carbamate (CAS 21208-62-8) is a chemical compound with the molecular formula C9H10ClNO4S and a molecular weight of 263.70 g/mol. IUPAC name: ethyl N-(4-chlorosulfonylphenyl)carbamate. InChIKey: QIJQSTNYYPTNBF-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO4S |
|---|---|
| Molecular weight | 263.70 g/mol |
| IUPAC name | ethyl N-(4-chlorosulfonylphenyl)carbamate |
| InChIKey | QIJQSTNYYPTNBF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)NC1=CC=C(C=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)