CAS 3746-67-6 appears in our catalog under these names: 3-Acetamido-4-methoxy benzenesulphonyl chloride, 95%, 3-Acetamido-4-methoxybenzene-1-sulfonyl chloride, 98+%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 5g, 1g, 250mg, on request.
3-acetamido-4-methoxybenzenesulfonyl chloride (CAS 3746-67-6) is a chemical compound with the molecular formula C9H10ClNO4S and a molecular weight of 263.70 g/mol. IUPAC name: 3-acetamido-4-methoxybenzenesulfonyl chloride. InChIKey: KRKMAUKQDRAOFI-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO4S |
|---|---|
| Molecular weight | 263.70 g/mol |
| IUPAC name | 3-acetamido-4-methoxybenzenesulfonyl chloride |
| InChIKey | KRKMAUKQDRAOFI-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=CC(=C1)S(=O)(=O)Cl)OC |
Computed by PubChem (NCBI)