CAS 1009228-47-0 appears in our catalog under these names: 5-Amino-2-([(3,4-dimethylphenyl)sulfonyl]amino)-5-oxopentanoic acid, 95%, 4-Carbamoyl-2-(3,4-dimethylbenzenesulfonamido)butanoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
5-amino-2-[(3,4-dimethylphenyl)sulfonylamino]-5-oxopentanoic acid (CAS 1009228-47-0) is a chemical compound with the molecular formula C13H18N2O5S and a molecular weight of 314.36 g/mol. IUPAC name: 5-amino-2-[(3,4-dimethylphenyl)sulfonylamino]-5-oxopentanoic acid. InChIKey: NMXOUNKQTBTTJA-UHFFFAOYSA-N.
| Molecular formula | C13H18N2O5S |
|---|---|
| Molecular weight | 314.36 g/mol |
| IUPAC name | 5-amino-2-[(3,4-dimethylphenyl)sulfonylamino]-5-oxopentanoic acid |
| InChIKey | NMXOUNKQTBTTJA-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)S(=O)(=O)NC(CCC(=O)N)C(=O)O)C |
Computed by PubChem (NCBI)