CAS 1396962-35-8 is the registry number for 4-Carbamoyl-2-(2,4-dimethylbenzenesulfonamido)butanoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
5-amino-2-[(2,4-dimethylphenyl)sulfonylamino]-5-oxopentanoic acid (CAS 1396962-35-8) is a chemical compound with the molecular formula C13H18N2O5S and a molecular weight of 314.36 g/mol. IUPAC name: 5-amino-2-[(2,4-dimethylphenyl)sulfonylamino]-5-oxopentanoic acid. InChIKey: XRCFYLHXXLSTTD-UHFFFAOYSA-N.
| Molecular formula | C13H18N2O5S |
|---|---|
| Molecular weight | 314.36 g/mol |
| IUPAC name | 5-amino-2-[(2,4-dimethylphenyl)sulfonylamino]-5-oxopentanoic acid |
| InChIKey | XRCFYLHXXLSTTD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)S(=O)(=O)NC(CCC(=O)N)C(=O)O)C |
Computed by PubChem (NCBI)