CAS 263897-16-1 is the registry number for 2-Methoxy-5-((4-methylpiperazin-1-yl)sulfonyl)benzoic acid. Offered by: TRC. Available pack sizes: 500mg.
2-methoxy-5-(4-methylpiperazin-1-yl)sulfonylbenzoic acid (CAS 263897-16-1) is a chemical compound with the molecular formula C13H18N2O5S and a molecular weight of 314.36 g/mol. IUPAC name: 2-methoxy-5-(4-methylpiperazin-1-yl)sulfonylbenzoic acid. InChIKey: WKHHHZDKDHGOOA-UHFFFAOYSA-N.
| Molecular formula | C13H18N2O5S |
|---|---|
| Molecular weight | 314.36 g/mol |
| IUPAC name | 2-methoxy-5-(4-methylpiperazin-1-yl)sulfonylbenzoic acid |
| InChIKey | WKHHHZDKDHGOOA-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)S(=O)(=O)C2=CC(=C(C=C2)OC)C(=O)O |
Computed by PubChem (NCBI)