Products 729578-96-5

CAS 729578-96-5 is the registry number for (4-Diethylsulfamoyl-benzoylamino)-acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

2-[[4-(diethylsulfamoyl)benzoyl]amino]acetic acid (CAS 729578-96-5) is a chemical compound with the molecular formula C13H18N2O5S and a molecular weight of 314.36 g/mol. IUPAC name: 2-[[4-(diethylsulfamoyl)benzoyl]amino]acetic acid. InChIKey: XNAAZUFOJHYJSL-UHFFFAOYSA-N.

Identity
Molecular formulaC13H18N2O5S
Molecular weight314.36 g/mol
IUPAC name2-[[4-(diethylsulfamoyl)benzoyl]amino]acetic acid
InChIKeyXNAAZUFOJHYJSL-UHFFFAOYSA-N
SMILESCCN(CC)S(=O)(=O)C1=CC=C(C=C1)C(=O)NCC(=O)O

Computed by PubChem (NCBI)