CAS 1185126-97-9 appears in our catalog under these names: 4-Carboxy Tolbutamide-d9 Methyl Ester, Methyl 4-(N-(butylcarbamoyl)sulfamoyl)benzoate-d9. Offered by: TRC, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 25 mg, 2.5 mg.
Methyl 4-(1,1,2,2,3,3,4,4,4-nonadeuteriobutylcarbamoylsulfamoyl)benzoate (CAS 1185126-97-9) is a chemical compound with the molecular formula C13H18N2O5S and a molecular weight of 323.41 g/mol. IUPAC name: methyl 4-(1,1,2,2,3,3,4,4,4-nonadeuteriobutylcarbamoylsulfamoyl)benzoate. InChIKey: ZLNXHCAHLBRDBT-ZYWCKPJZSA-N.
| Molecular formula | C13H18N2O5S |
|---|---|
| Molecular weight | 323.41 g/mol |
| IUPAC name | methyl 4-(1,1,2,2,3,3,4,4,4-nonadeuteriobutylcarbamoylsulfamoyl)benzoate |
| InChIKey | ZLNXHCAHLBRDBT-ZYWCKPJZSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])NC(=O)NS(=O)(=O)C1=CC=C(C=C1)C(=O)OC |
Computed by PubChem (NCBI)