CAS 1009486-78-5 appears in our catalog under these names: 5-Amino-2-([(2,5-dimethylphenyl)sulfonyl]amino)-5-oxopentanoic acid, 95%, 4-Carbamoyl-2-(2,5-dimethylbenzenesulfonamido)butanoic acid, 95%, 4-Carbamoyl-2-(2,5-dimethylbenzenesulfonamido)butanoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
5-amino-2-[(2,5-dimethylphenyl)sulfonylamino]-5-oxopentanoic acid (CAS 1009486-78-5) is a chemical compound with the molecular formula C13H18N2O5S and a molecular weight of 314.36 g/mol. IUPAC name: 5-amino-2-[(2,5-dimethylphenyl)sulfonylamino]-5-oxopentanoic acid. InChIKey: BCXWYNWLIBJFMK-UHFFFAOYSA-N.
| Molecular formula | C13H18N2O5S |
|---|---|
| Molecular weight | 314.36 g/mol |
| IUPAC name | 5-amino-2-[(2,5-dimethylphenyl)sulfonylamino]-5-oxopentanoic acid |
| InChIKey | BCXWYNWLIBJFMK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)S(=O)(=O)NC(CCC(=O)N)C(=O)O |
Computed by PubChem (NCBI)