CAS 620103-21-1 is the registry number for Benzoic acid, 4-((4-(2-hydroxyethyl)-1-piperazinyl)sulfonyl)-, 97%. Offered by: AmBeed. Available pack sizes: 10g, 5g.
4-[4-(2-hydroxyethyl)piperazin-1-yl]sulfonylbenzoic acid (CAS 620103-21-1) is a chemical compound with the molecular formula C13H18N2O5S and a molecular weight of 314.36 g/mol. IUPAC name: 4-[4-(2-hydroxyethyl)piperazin-1-yl]sulfonylbenzoic acid. InChIKey: MWIVTBBXKLCFRZ-UHFFFAOYSA-N.
| Molecular formula | C13H18N2O5S |
|---|---|
| Molecular weight | 314.36 g/mol |
| IUPAC name | 4-[4-(2-hydroxyethyl)piperazin-1-yl]sulfonylbenzoic acid |
| InChIKey | MWIVTBBXKLCFRZ-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CCO)S(=O)(=O)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)