Products 1009339-36-9
CAS 1009339-36-9 is the registry number for 2,6-Dimethyl 4-(trifluoromethyl)-2,6-pyridinedicarboxylate, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
Dimethyl 4-(trifluoromethyl)pyridine-2,6-dicarboxylate (CAS 1009339-36-9) is a chemical compound with the molecular formula C10H8F3NO4 and a molecular weight of 263.17 g/mol. IUPAC name: dimethyl 4-(trifluoromethyl)pyridine-2,6-dicarboxylate. InChIKey: VZTBHZLMFBGYRC-UHFFFAOYSA-N.
| Molecular formula | C10H8F3NO4 |
|---|---|
| Molecular weight | 263.17 g/mol |
| IUPAC name | dimethyl 4-(trifluoromethyl)pyridine-2,6-dicarboxylate |
| InChIKey | VZTBHZLMFBGYRC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC(=N1)C(=O)OC)C(F)(F)F |
Computed by PubChem (NCBI)