CAS 1010129-08-4 appears in our catalog under these names: (R)–4–Amino–4–phenylbutanoic acid hydrochloride, (R)-4-Amino-4-phenylbutanoic acid hydrochloride, 97%, (R)-4-Amino-4-phenylbutanoic acid hydrochloride, 97%, 97%, (gammaR)-gamma-Aminobenzenebutanoic Acid Hydrochloride. Offered by: GLPBio, Fluorochem, Ambeed, Chemat, TRC. Available pack sizes: 100mg, 250mg, 1g, 5g, 500mg.
(4R)-4-amino-4-phenylbutanoic acid;hydrochloride (CAS 1010129-08-4) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: (4R)-4-amino-4-phenylbutanoic acid;hydrochloride. InChIKey: HWYVTLZMBWZXGN-SBSPUUFOSA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 215.67 g/mol |
| IUPAC name | (4R)-4-amino-4-phenylbutanoic acid;hydrochloride |
| InChIKey | HWYVTLZMBWZXGN-SBSPUUFOSA-N |
| SMILES | C1=CC=C(C=C1)[C@@H](CCC(=O)O)N.Cl |
Computed by PubChem (NCBI)