Products 122602-44-2
CAS 122602-44-2 appears in our catalog under these names: 4–Amino–4–phenylbutanoic acid hydrochloride, 4-Amino-4-phenyl-butyric acid hydrochloride, 4-Amino-4-phenylbutanoic acid hydrochloride, 95%, 95%, 4-Amino-4-phenylbutanoic acid hydrochloride, 95%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 2,5g, 1g.
4-amino-4-phenylbutanoic acid;hydrochloride (CAS 122602-44-2) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: 4-amino-4-phenylbutanoic acid;hydrochloride. InChIKey: HWYVTLZMBWZXGN-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 215.67 g/mol |
| IUPAC name | 4-amino-4-phenylbutanoic acid;hydrochloride |
| InChIKey | HWYVTLZMBWZXGN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CCC(=O)O)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
4-amino-4-phenylbutanoic acid hydrochloride, 4-Amino-4-phenyl-butyric acid hydrochloride, 4-amino-4-phenylbutanoic acid;hydrochloride, 4-amino-4-phenylbutanoicacidhydrochloride, (gammaR)-gamma-Aminobenzenebutanoic Acid HCl, 4-amino-4-phenyl-butanoic acid;hydrochloride, Benzenebutanoic acid, gamma-amino-, hydrochloride