Products 56523-54-7
CAS 56523-54-7 appears in our catalog under these names: (S)–4–Amino–4–phenyl–butyric acid hydrochloride, (S)-4-Amino-4-phenyl-butyric acid hydrochloride, (S)-4-Amino-4-phenylbutyric acid hydrochloride, 97%, 97%, (S)-4-Amino-4-phenyl-butyric acid hydrochloride, 97%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 5g, 1g, 250mg, 50mg, 500mg.
(4S)-4-amino-4-phenylbutanoic acid;hydrochloride (CAS 56523-54-7) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: (4S)-4-amino-4-phenylbutanoic acid;hydrochloride. InChIKey: HWYVTLZMBWZXGN-FVGYRXGTSA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 215.67 g/mol |
| IUPAC name | (4S)-4-amino-4-phenylbutanoic acid;hydrochloride |
| InChIKey | HWYVTLZMBWZXGN-FVGYRXGTSA-N |
| SMILES | C1=CC=C(C=C1)[C@H](CCC(=O)O)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
(S)-4-Amino-4-phenyl-butyric acid hydrochloride, (S)-4-amino-4-phenylbutanoic acid hydrochloride, (S)-4-Amino-4-phenylbutyric acid hydrochloride, (4S)-4-amino-4-phenylbutanoic acid;hydrochloride, (4S)-4-amino-4-phenylbutanoic acid hydrochloride, (S)-4-Amino-4-phenyl-butyricacidhydrochloride, (4S)-4-amino-4-phenyl-butanoic acid;hydrochloride, 4-Amino-4-phenylbutanoic acid hydrochloride, (S)-, Benzenebutanoic acid, gamma-amino-, hydrochloride, (S)-, (S)-4-Amino-4-phenyl-butyric acid hydrochloride - [A91989]