CAS 101072-61-1 appears in our catalog under these names: Nitrendipine Impurity 4, Nimodipine Impurity 3, Nicardipine Impurity 5. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(2E)-2-[(3-nitrophenyl)methylidene]-3-oxobutanoic acid (CAS 101072-61-1) is a chemical compound with the molecular formula C11H9NO5 and a molecular weight of 235.19 g/mol. IUPAC name: (2E)-2-[(3-nitrophenyl)methylidene]-3-oxobutanoic acid. InChIKey: QXLGUWJCTSGSDB-UXBLZVDNSA-N.
| Molecular formula | C11H9NO5 |
|---|---|
| Molecular weight | 235.19 g/mol |
| IUPAC name | (2E)-2-[(3-nitrophenyl)methylidene]-3-oxobutanoic acid |
| InChIKey | QXLGUWJCTSGSDB-UXBLZVDNSA-N |
| SMILES | CC(=O)/C(=C\C1=CC(=CC=C1)[N+](=O)[O-])/C(=O)O |
Computed by PubChem (NCBI)