Products 62983-58-8

CAS 62983-58-8 is the registry number for 3-(1,3-Dioxoisoindolin-2-yl)-2-hydroxypropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-(1,3-dioxoisoindol-2-yl)-2-hydroxypropanoic acid (CAS 62983-58-8) is a chemical compound with the molecular formula C11H9NO5 and a molecular weight of 235.19 g/mol. IUPAC name: 3-(1,3-dioxoisoindol-2-yl)-2-hydroxypropanoic acid. InChIKey: FTYIPEUXWXPNBZ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H9NO5
Molecular weight235.19 g/mol
IUPAC name3-(1,3-dioxoisoindol-2-yl)-2-hydroxypropanoic acid
InChIKeyFTYIPEUXWXPNBZ-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(=O)N(C2=O)CC(C(=O)O)O

Computed by PubChem (NCBI)