Products 62530-49-8

CAS 62530-49-8 is the registry number for 2-(3-Carboxyprop-2-enoylamino)benzoic acid, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 10g.

2-[[(E)-3-carboxyprop-2-enoyl]amino]benzoic acid (CAS 62530-49-8) is a chemical compound with the molecular formula C11H9NO5 and a molecular weight of 235.19 g/mol. IUPAC name: 2-[[(E)-3-carboxyprop-2-enoyl]amino]benzoic acid. InChIKey: QRJVIZCSCVUXBG-AATRIKPKSA-N.

Identity
Molecular formulaC11H9NO5
Molecular weight235.19 g/mol
IUPAC name2-[[(E)-3-carboxyprop-2-enoyl]amino]benzoic acid
InChIKeyQRJVIZCSCVUXBG-AATRIKPKSA-N
SMILESC1=CC=C(C(=C1)C(=O)O)NC(=O)/C=C/C(=O)O

Computed by PubChem (NCBI)