Products 19612-68-1
CAS 19612-68-1 is the registry number for 2-(5-Methoxy-2,3-dioxo-2,3-dihydro-1h-indol-1-yl)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(5-methoxy-2,3-dioxoindol-1-yl)acetic acid (CAS 19612-68-1) is a chemical compound with the molecular formula C11H9NO5 and a molecular weight of 235.19 g/mol. IUPAC name: 2-(5-methoxy-2,3-dioxoindol-1-yl)acetic acid. InChIKey: GYPZZPCGDKDTQF-UHFFFAOYSA-N.
| Molecular formula | C11H9NO5 |
|---|---|
| Molecular weight | 235.19 g/mol |
| IUPAC name | 2-(5-methoxy-2,3-dioxoindol-1-yl)acetic acid |
| InChIKey | GYPZZPCGDKDTQF-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)N(C(=O)C2=O)CC(=O)O |
Computed by PubChem (NCBI)