CAS 1311070-25-3 is the registry number for 5-(4-Hydroxy-3-methoxyphenyl)isoxazole-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(4-hydroxy-3-methoxyphenyl)-1,2-oxazole-3-carboxylic acid (CAS 1311070-25-3) is a chemical compound with the molecular formula C11H9NO5 and a molecular weight of 235.19 g/mol. IUPAC name: 5-(4-hydroxy-3-methoxyphenyl)-1,2-oxazole-3-carboxylic acid. InChIKey: VQTZNFBTPOWKAQ-UHFFFAOYSA-N.
| Molecular formula | C11H9NO5 |
|---|---|
| Molecular weight | 235.19 g/mol |
| IUPAC name | 5-(4-hydroxy-3-methoxyphenyl)-1,2-oxazole-3-carboxylic acid |
| InChIKey | VQTZNFBTPOWKAQ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C2=CC(=NO2)C(=O)O)O |
Computed by PubChem (NCBI)