CAS 133319-36-5 is the registry number for (S)-3-(1,3-Dioxoisoindolin-2-yl)-2-hydroxypropanoic acid, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-3-(1,3-dioxoisoindol-2-yl)-2-hydroxypropanoic acid (CAS 133319-36-5) is a chemical compound with the molecular formula C11H9NO5 and a molecular weight of 235.19 g/mol. IUPAC name: (2S)-3-(1,3-dioxoisoindol-2-yl)-2-hydroxypropanoic acid. InChIKey: FTYIPEUXWXPNBZ-QMMMGPOBSA-N.
| Molecular formula | C11H9NO5 |
|---|---|
| Molecular weight | 235.19 g/mol |
| IUPAC name | (2S)-3-(1,3-dioxoisoindol-2-yl)-2-hydroxypropanoic acid |
| InChIKey | FTYIPEUXWXPNBZ-QMMMGPOBSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)C[C@@H](C(=O)O)O |
Computed by PubChem (NCBI)