CAS 179114-94-4 is the registry number for Dimethyl 2-isocyanatoterephthalate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 10g, 25g, 1g.
Dimethyl 2-isocyanatobenzene-1,4-dicarboxylate (CAS 179114-94-4) is a chemical compound with the molecular formula C11H9NO5 and a molecular weight of 235.19 g/mol. IUPAC name: dimethyl 2-isocyanatobenzene-1,4-dicarboxylate. InChIKey: VLBOVVSWDHUHJK-UHFFFAOYSA-N.
| Molecular formula | C11H9NO5 |
|---|---|
| Molecular weight | 235.19 g/mol |
| IUPAC name | dimethyl 2-isocyanatobenzene-1,4-dicarboxylate |
| InChIKey | VLBOVVSWDHUHJK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)C(=O)OC)N=C=O |
Computed by PubChem (NCBI)