Products 1010800-27-7
CAS 1010800-27-7 is the registry number for 4-Ethyl-1h-pyrazol-3-amine oxalate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-ethyl-1H-pyrazol-5-amine;oxalic acid (CAS 1010800-27-7) is a chemical compound with the molecular formula C7H11N3O4 and a molecular weight of 201.18 g/mol. IUPAC name: 4-ethyl-1H-pyrazol-5-amine;oxalic acid. InChIKey: FVLVDCDPTRTWLR-UHFFFAOYSA-N.
| Molecular formula | C7H11N3O4 |
|---|---|
| Molecular weight | 201.18 g/mol |
| IUPAC name | 4-ethyl-1H-pyrazol-5-amine;oxalic acid |
| InChIKey | FVLVDCDPTRTWLR-UHFFFAOYSA-N |
| SMILES | CCC1=C(NN=C1)N.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)
Synonyms:
4-Ethyl-1H-pyrazol-3-amine oxalate, 3-Amino-4-Ethylpyrazole Oxalate, 4-ethyl-1H-pyrazol-5-amine;oxalic acid, 4-Ethyl-1H-pyrazol-5-amine oxalate, 3-amino-4-ethyl pyrazole oxalate, FVLVDCDPTRTWLR-UHFFFAOYSA-N, 4-Ethyl-1H-pyrazol-3-amineoxalate, 4-ethyl-1H-pyrazol-3-ylamine oxalate, 4-ethyl-1H-pyrazol-3-amine oxalic acid, 4-ethyl-1h-pyrazol-5-amine oxalic Acid