Products 2727907-22-2
CAS 2727907-22-2 is the registry number for 5-(2-Methoxyethoxy)-1-methyl-3-nitro-1H-pyrazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(2-methoxyethoxy)-1-methyl-3-nitropyrazole (CAS 2727907-22-2) is a chemical compound with the molecular formula C7H11N3O4 and a molecular weight of 201.18 g/mol. IUPAC name: 5-(2-methoxyethoxy)-1-methyl-3-nitropyrazole. InChIKey: GQHQODMYGHMFLD-UHFFFAOYSA-N.
| Molecular formula | C7H11N3O4 |
|---|---|
| Molecular weight | 201.18 g/mol |
| IUPAC name | 5-(2-methoxyethoxy)-1-methyl-3-nitropyrazole |
| InChIKey | GQHQODMYGHMFLD-UHFFFAOYSA-N |
| SMILES | CN1C(=CC(=N1)[N+](=O)[O-])OCCOC |
Computed by PubChem (NCBI)