CAS 681816-65-9 is the registry number for Methyl 4-(2-Azidoethoxy)-3-oxobutanoic Acid Ester. Offered by: TRC. Available pack sizes: 1g.
Methyl 4-(2-azidoethoxy)-3-oxobutanoate (CAS 681816-65-9) is a chemical compound with the molecular formula C7H11N3O4 and a molecular weight of 201.18 g/mol. IUPAC name: methyl 4-(2-azidoethoxy)-3-oxobutanoate. InChIKey: PGYPIHYREPVSRY-UHFFFAOYSA-N.
| Molecular formula | C7H11N3O4 |
|---|---|
| Molecular weight | 201.18 g/mol |
| IUPAC name | methyl 4-(2-azidoethoxy)-3-oxobutanoate |
| InChIKey | PGYPIHYREPVSRY-UHFFFAOYSA-N |
| SMILES | COC(=O)CC(=O)COCCN=[N+]=[N-] |
Computed by PubChem (NCBI)