CAS 605669-75-8 is the registry number for methyl (2R,4S,5R)-4-azido-5-(hydroxymethyl)tetrahydrofuran-2-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Methyl (2R,4S,5R)-4-azido-5-(hydroxymethyl)oxolane-2-carboxylate (CAS 605669-75-8) is a chemical compound with the molecular formula C7H11N3O4 and a molecular weight of 201.18 g/mol. IUPAC name: methyl (2R,4S,5R)-4-azido-5-(hydroxymethyl)oxolane-2-carboxylate. InChIKey: FAFWVWDWMIPWQR-JKUQZMGJSA-N.
| Molecular formula | C7H11N3O4 |
|---|---|
| Molecular weight | 201.18 g/mol |
| IUPAC name | methyl (2R,4S,5R)-4-azido-5-(hydroxymethyl)oxolane-2-carboxylate |
| InChIKey | FAFWVWDWMIPWQR-JKUQZMGJSA-N |
| SMILES | COC(=O)[C@H]1C[C@@H]([C@@H](O1)CO)N=[N+]=[N-] |
Computed by PubChem (NCBI)