Products 126865-27-8

CAS 126865-27-8 is the registry number for Methyl 5-amino-3-(2-hydroxyethoxy)-1H-pyrazole-4-carboxylate. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 3-amino-5-(2-hydroxyethoxy)-1H-pyrazole-4-carboxylate (CAS 126865-27-8) is a chemical compound with the molecular formula C7H11N3O4 and a molecular weight of 201.18 g/mol. IUPAC name: methyl 3-amino-5-(2-hydroxyethoxy)-1H-pyrazole-4-carboxylate. InChIKey: CYZGVWSQKSVJKL-UHFFFAOYSA-N.

Identity
Molecular formulaC7H11N3O4
Molecular weight201.18 g/mol
IUPAC namemethyl 3-amino-5-(2-hydroxyethoxy)-1H-pyrazole-4-carboxylate
InChIKeyCYZGVWSQKSVJKL-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(NN=C1N)OCCO

Computed by PubChem (NCBI)