CAS 62580-80-7 appears in our catalog under these names: Ornidazole Diol, 3-Deschloro-3-hydroxy Ornidazole, 3-(2-Methyl-5-nitro-1H-imidazol-1-yl)propane-1,2-diol, Ornidazole-6-deschloro-6-hydroxy, Ornidazole diol. Offered by: Chemat Brand, TRC, Mikromol, Dr. Ehrenstorfer, GLPBio. Available pack sizes: on request, 100mg, 10mg, 500mg, 4x25mg, 25mg, 5mg, 50mg.
3-(2-methyl-5-nitroimidazol-1-yl)propane-1,2-diol (CAS 62580-80-7) is a chemical compound with the molecular formula C7H11N3O4 and a molecular weight of 201.18 g/mol. IUPAC name: 3-(2-methyl-5-nitroimidazol-1-yl)propane-1,2-diol. InChIKey: QQNYOVQUGLPEFB-UHFFFAOYSA-N.
| Molecular formula | C7H11N3O4 |
|---|---|
| Molecular weight | 201.18 g/mol |
| IUPAC name | 3-(2-methyl-5-nitroimidazol-1-yl)propane-1,2-diol |
| InChIKey | QQNYOVQUGLPEFB-UHFFFAOYSA-N |
| SMILES | CC1=NC=C(N1CC(CO)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)